About 4-(2,6-dimethylthiomorpholin-4-yl)but-2-en-1-amine
4-(2,6-dimethylthiomorpholin-4-yl)but-2-en-1-amine (PubChem CID 77110319) has the molecular formula C10H20N2S
and a molecular weight of 200.35 g/mol. Its IUPAC name is 4-(2,6-dimethylthiomorpholin-4-yl)but-2-en-1-amine.
Molecular Properties
| Compound Name | 4-(2,6-dimethylthiomorpholin-4-yl)but-2-en-1-amine |
| PubChem CID | 77110319 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 4-(2,6-dimethylthiomorpholin-4-yl)but-2-en-1-amine |
| SMILES | CC1CN(CC=CCN)CC(C)S1 |
| InChI | InChI=1S/C10H20N2S/c1-9-7-12(6-4-3-5-11)8-10(2)13-9/h3-4,9-10H,5-8,11H2,1-2H3 |
| InChIKey | UKKOOFSPSRXNEN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,6-dimethylthiomorpholin-4-yl)but-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,6-dimethylthiomorpholin-4-yl)but-2-en-1-amine?
The IUPAC name of 4-(2,6-dimethylthiomorpholin-4-yl)but-2-en-1-amine (CID 77110319) is 4-(2,6-dimethylthiomorpholin-4-yl)but-2-en-1-amine.
What is the SMILES notation for 4-(2,6-dimethylthiomorpholin-4-yl)but-2-en-1-amine?
The canonical SMILES for 4-(2,6-dimethylthiomorpholin-4-yl)but-2-en-1-amine is CC1CN(CC=CCN)CC(C)S1.
What is the InChIKey of 4-(2,6-dimethylthiomorpholin-4-yl)but-2-en-1-amine?
The InChIKey is UKKOOFSPSRXNEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2S/c1-9-7-12(6-4-3-5-11)8-10(2)13-9/h3-4,9-10H,5-8,11H2,1-2H3.
What are the key properties of 4-(2,6-dimethylthiomorpholin-4-yl)but-2-en-1-amine?
4-(2,6-dimethylthiomorpholin-4-yl)but-2-en-1-amine has a molecular weight of 200.35 g/mol, XLogP of 1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,6-dimethylthiomorpholin-4-yl)but-2-en-1-amine is sourced from PubChem (CID 77110319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).