About 4-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxybut-2-en-1-amine
4-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxybut-2-en-1-amine (PubChem CID 77110517) has the molecular formula C14H14N2OS2
and a molecular weight of 290.41 g/mol. Its IUPAC name is 4-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxybut-2-en-1-amine.
Molecular Properties
| Compound Name | 4-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxybut-2-en-1-amine |
| PubChem CID | 77110517 |
| Molecular Formula | C14H14N2OS2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 4-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxybut-2-en-1-amine |
| SMILES | Cc1nc2c(cc(OCC=CCN)c3ccsc32)s1 |
| InChI | InChI=1S/C14H14N2OS2/c1-9-16-13-12(19-9)8-11(17-6-3-2-5-15)10-4-7-18-14(10)13/h2-4,7-8H,5-6,15H2,1H3 |
| InChIKey | ODCZOVFDJIFUOF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxybut-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxybut-2-en-1-amine?
The IUPAC name of 4-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxybut-2-en-1-amine (CID 77110517) is 4-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxybut-2-en-1-amine.
What is the SMILES notation for 4-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxybut-2-en-1-amine?
The canonical SMILES for 4-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxybut-2-en-1-amine is Cc1nc2c(cc(OCC=CCN)c3ccsc32)s1.
What is the InChIKey of 4-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxybut-2-en-1-amine?
The InChIKey is ODCZOVFDJIFUOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2OS2/c1-9-16-13-12(19-9)8-11(17-6-3-2-5-15)10-4-7-18-14(10)13/h2-4,7-8H,5-6,15H2,1H3.
What are the key properties of 4-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxybut-2-en-1-amine?
4-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxybut-2-en-1-amine has a molecular weight of 290.41 g/mol, XLogP of 3.71, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxybut-2-en-1-amine is sourced from PubChem (CID 77110517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).