C10H18N4 — CID 77110593
N'-methyl-N'-[(1-methylimidazol-2-yl)methyl]but-2-ene-1,4-diamine (PubChem CID 77110593) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is N'-methyl-N'-[(1-methylimidazol-2-yl)methyl]but-2-ene-1,4-diamine.
| Compound Name | N'-methyl-N'-[(1-methylimidazol-2-yl)methyl]but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 77110593 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | N'-methyl-N'-[(1-methylimidazol-2-yl)methyl]but-2-ene-1,4-diamine |
| SMILES | CN(CC=CCN)Cc1nccn1C |
| InChI | InChI=1S/C10H18N4/c1-13(7-4-3-5-11)9-10-12-6-8-14(10)2/h3-4,6,8H,5,7,9,11H2,1-2H3 |
| InChIKey | JTPBPDPURJVPCC-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|