C12H17FN2 — CID 77110788
N'-ethyl-N'-(3-fluorophenyl)but-2-ene-1,4-diamine (PubChem CID 77110788) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is N'-ethyl-N'-(3-fluorophenyl)but-2-ene-1,4-diamine.
| Compound Name | N'-ethyl-N'-(3-fluorophenyl)but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 77110788 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | N'-ethyl-N'-(3-fluorophenyl)but-2-ene-1,4-diamine |
| SMILES | CCN(CC=CCN)c1cccc(F)c1 |
| InChI | InChI=1S/C12H17FN2/c1-2-15(9-4-3-8-14)12-7-5-6-11(13)10-12/h3-7,10H,2,8-9,14H2,1H3 |
| InChIKey | NYCLRRVMDCMUTL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|