C14H16FNO2 — CID 77111150
3-(3-fluorophenyl)-N-[(3-hydroxycyclobutyl)methyl]prop-2-enamide (PubChem CID 77111150) has the molecular formula C14H16FNO2 and a molecular weight of 249.28 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-[(3-hydroxycyclobutyl)methyl]prop-2-enamide.
| Compound Name | 3-(3-fluorophenyl)-N-[(3-hydroxycyclobutyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 77111150 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 3-(3-fluorophenyl)-N-[(3-hydroxycyclobutyl)methyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cccc(F)c1)NCC1CC(O)C1 |
| InChI | InChI=1S/C14H16FNO2/c15-12-3-1-2-10(6-12)4-5-14(18)16-9-11-7-13(17)8-11/h1-6,11,13,17H,7-9H2,(H,16,18) |
| InChIKey | LMZXUZVCGRRUHR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|