C14H13FN2O4 — CID 77111264
3-[3-fluoro-4-(2-methyl-3,5-dioxopiperazin-1-yl)phenyl]prop-2-enoic acid (PubChem CID 77111264) has the molecular formula C14H13FN2O4 and a molecular weight of 292.27 g/mol. Its IUPAC name is 3-[3-fluoro-4-(2-methyl-3,5-dioxopiperazin-1-yl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-fluoro-4-(2-methyl-3,5-dioxopiperazin-1-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77111264 |
| Molecular Formula | C14H13FN2O4 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3-[3-fluoro-4-(2-methyl-3,5-dioxopiperazin-1-yl)phenyl]prop-2-enoic acid |
| SMILES | CC1C(=O)NC(=O)CN1c1ccc(C=CC(=O)O)cc1F |
| InChI | InChI=1S/C14H13FN2O4/c1-8-14(21)16-12(18)7-17(8)11-4-2-9(6-10(11)15)3-5-13(19)20/h2-6,8H,7H2,1H3,(H,19,20)(H,16,18,21) |
| InChIKey | KKUAEKAQFNHTHE-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|