C12H24N4O3 — CID 77111561
3-[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]-N'-hydroxy-2,2-dimethyl-3-oxopropanimidamide (PubChem CID 77111561) has the molecular formula C12H24N4O3 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]-N'-hydroxy-2,2-dimethyl-3-oxopropanimidamide.
| Compound Name | 3-[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]-N'-hydroxy-2,2-dimethyl-3-oxopropanimidamide |
|---|---|
| PubChem CID | 77111561 |
| Molecular Formula | C12H24N4O3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 3-[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]-N'-hydroxy-2,2-dimethyl-3-oxopropanimidamide |
| SMILES | CN(C)CC1CC(O)CN1C(=O)C(C)(C)C(N)=NO |
| InChI | InChI=1S/C12H24N4O3/c1-12(2,10(13)14-19)11(18)16-7-9(17)5-8(16)6-15(3)4/h8-9,17,19H,5-7H2,1-4H3,(H2,13,14) |
| InChIKey | ZBPXDZRDIVDDRW-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|