C11H13F3N2O2S — CID 77112989
N'-hydroxy-4-(3-hydroxypropylsulfanyl)-2-(trifluoromethyl)benzenecarboximidamide (PubChem CID 77112989) has the molecular formula C11H13F3N2O2S and a molecular weight of 294.30 g/mol. Its IUPAC name is N'-hydroxy-4-(3-hydroxypropylsulfanyl)-2-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-(3-hydroxypropylsulfanyl)-2-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 77112989 |
| Molecular Formula | C11H13F3N2O2S |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | N'-hydroxy-4-(3-hydroxypropylsulfanyl)-2-(trifluoromethyl)benzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(SCCCO)cc1C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O2S/c12-11(13,14)9-6-7(19-5-1-4-17)2-3-8(9)10(15)16-18/h2-3,6,17-18H,1,4-5H2,(H2,15,16) |
| InChIKey | LAPSGSNOPKZIKY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|