C17H23N4O+ — CID 7711309
(E)-2-cyano-3-(4-methylpiperazin-4-ium-1-yl)-N-(2-phenylethyl)prop-2-enamide (PubChem CID 7711309) has the molecular formula C17H23N4O+ and a molecular weight of 299.40 g/mol. Its IUPAC name is (E)-2-cyano-3-(4-methylpiperazin-4-ium-1-yl)-N-(2-phenylethyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(4-methylpiperazin-4-ium-1-yl)-N-(2-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 7711309 |
| Molecular Formula | C17H23N4O+ |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (E)-2-cyano-3-(4-methylpiperazin-4-ium-1-yl)-N-(2-phenylethyl)prop-2-enamide |
| SMILES | C[NH+]1CCN(/C=C(\C#N)C(=O)NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C17H22N4O/c1-20-9-11-21(12-10-20)14-16(13-18)17(22)19-8-7-15-5-3-2-4-6-15/h2-6,14H,7-12H2,1H3,(H,19,22)/p+1/b16-14+ |
| InChIKey | IYZDYXBAJGNBSQ-JQIJEIRASA-O |
| XLogP | -0.42 |
| TPSA | 60.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|