About 3-(hexa-2,4-dienoylamino)-2-hydroxypropanoic acid
3-(hexa-2,4-dienoylamino)-2-hydroxypropanoic acid (PubChem CID 77113678) has the molecular formula C9H13NO4
and a molecular weight of 199.21 g/mol. Its IUPAC name is 3-(hexa-2,4-dienoylamino)-2-hydroxypropanoic acid.
Molecular Properties
| Compound Name | 3-(hexa-2,4-dienoylamino)-2-hydroxypropanoic acid |
| PubChem CID | 77113678 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 3-(hexa-2,4-dienoylamino)-2-hydroxypropanoic acid |
| SMILES | CC=CC=CC(=O)NCC(O)C(=O)O |
| InChI | InChI=1S/C9H13NO4/c1-2-3-4-5-8(12)10-6-7(11)9(13)14/h2-5,7,11H,6H2,1H3,(H,10,12)(H,13,14) |
| InChIKey | UKVRIVHXCXQSLY-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-(hexa-2,4-dienoylamino)-2-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hexa-2,4-dienoylamino)-2-hydroxypropanoic acid?
The IUPAC name of 3-(hexa-2,4-dienoylamino)-2-hydroxypropanoic acid (CID 77113678) is 3-(hexa-2,4-dienoylamino)-2-hydroxypropanoic acid.
What is the SMILES notation for 3-(hexa-2,4-dienoylamino)-2-hydroxypropanoic acid?
The canonical SMILES for 3-(hexa-2,4-dienoylamino)-2-hydroxypropanoic acid is CC=CC=CC(=O)NCC(O)C(=O)O.
What is the InChIKey of 3-(hexa-2,4-dienoylamino)-2-hydroxypropanoic acid?
The InChIKey is UKVRIVHXCXQSLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO4/c1-2-3-4-5-8(12)10-6-7(11)9(13)14/h2-5,7,11H,6H2,1H3,(H,10,12)(H,13,14).
What are the key properties of 3-(hexa-2,4-dienoylamino)-2-hydroxypropanoic acid?
3-(hexa-2,4-dienoylamino)-2-hydroxypropanoic acid has a molecular weight of 199.21 g/mol, XLogP of -0.32, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hexa-2,4-dienoylamino)-2-hydroxypropanoic acid is sourced from PubChem (CID 77113678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).