C12H12BrNO4 — CID 77113748
3-[3-(3-bromophenyl)prop-2-enoylamino]-2-hydroxypropanoic acid (PubChem CID 77113748) has the molecular formula C12H12BrNO4 and a molecular weight of 314.13 g/mol. Its IUPAC name is 3-[3-(3-bromophenyl)prop-2-enoylamino]-2-hydroxypropanoic acid.
| Compound Name | 3-[3-(3-bromophenyl)prop-2-enoylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 77113748 |
| Molecular Formula | C12H12BrNO4 |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 3-[3-(3-bromophenyl)prop-2-enoylamino]-2-hydroxypropanoic acid |
| SMILES | O=C(C=Cc1cccc(Br)c1)NCC(O)C(=O)O |
| InChI | InChI=1S/C12H12BrNO4/c13-9-3-1-2-8(6-9)4-5-11(16)14-7-10(15)12(17)18/h1-6,10,15H,7H2,(H,14,16)(H,17,18) |
| InChIKey | RSIHTIRZXNUVBH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|