C20H17N3O7 — CID 7711401
(4-nitrophenyl)methyl 2-[(4R)-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl]acetate (PubChem CID 7711401) has the molecular formula C20H17N3O7 and a molecular weight of 411.37 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(4R)-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl]acetate.
| Compound Name | (4-nitrophenyl)methyl 2-[(4R)-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl]acetate |
|---|---|
| PubChem CID | 7711401 |
| Molecular Formula | C20H17N3O7 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(4R)-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl]acetate |
| SMILES | O=C(CN1C(=O)N[C@@]2(CCOc3ccccc32)C1=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H17N3O7/c24-17(30-12-13-5-7-14(8-6-13)23(27)28)11-22-18(25)20(21-19(22)26)9-10-29-16-4-2-1-3-15(16)20/h1-8H,9-12H2,(H,21,26)/t20-/m1/s1 |
| InChIKey | PRMYIYCYZAEJLP-HXUWFJFHSA-N |
| XLogP | 1.87 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|