C14H31N3O2 — CID 77114081
N'-hydroxy-5-[(2-hydroxy-2,4-dimethylpentyl)amino]-2,2-dimethylpentanimidamide (PubChem CID 77114081) has the molecular formula C14H31N3O2 and a molecular weight of 273.42 g/mol. Its IUPAC name is N'-hydroxy-5-[(2-hydroxy-2,4-dimethylpentyl)amino]-2,2-dimethylpentanimidamide.
| Compound Name | N'-hydroxy-5-[(2-hydroxy-2,4-dimethylpentyl)amino]-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 77114081 |
| Molecular Formula | C14H31N3O2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.24 |
| IUPAC Name | N'-hydroxy-5-[(2-hydroxy-2,4-dimethylpentyl)amino]-2,2-dimethylpentanimidamide |
| SMILES | CC(C)CC(C)(O)CNCCCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C14H31N3O2/c1-11(2)9-14(5,18)10-16-8-6-7-13(3,4)12(15)17-19/h11,16,18-19H,6-10H2,1-5H3,(H2,15,17) |
| InChIKey | KBAUEOUDPOWEMO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|