C10H23N3O3 — CID 77114403
4-[(2,3-dihydroxy-2-methylpropyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 77114403) has the molecular formula C10H23N3O3 and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-[(2,3-dihydroxy-2-methylpropyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide.
| Compound Name | 4-[(2,3-dihydroxy-2-methylpropyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 77114403 |
| Molecular Formula | C10H23N3O3 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.17 |
| IUPAC Name | 4-[(2,3-dihydroxy-2-methylpropyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | CC(O)(CO)CNCCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C10H23N3O3/c1-9(2,8(11)13-16)4-5-12-6-10(3,15)7-14/h12,14-16H,4-7H2,1-3H3,(H2,11,13) |
| InChIKey | DWIGHEXWNYQOMK-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|