C17H21FN2O — CID 77114648
1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-3-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 77114648) has the molecular formula C17H21FN2O and a molecular weight of 288.37 g/mol. Its IUPAC name is 1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-3-(4-fluorophenyl)prop-2-en-1-one.
| Compound Name | 1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-3-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 77114648 |
| Molecular Formula | C17H21FN2O |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-3-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | CCC1C2CNCC2CN1C(=O)C=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H21FN2O/c1-2-16-15-10-19-9-13(15)11-20(16)17(21)8-5-12-3-6-14(18)7-4-12/h3-8,13,15-16,19H,2,9-11H2,1H3 |
| InChIKey | ONJHFZULSRBBQU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|