About 1-[(E)-3,3,3-trifluoroprop-1-enyl]cyclohexan-1-ol
1-[(E)-3,3,3-trifluoroprop-1-enyl]cyclohexan-1-ol (PubChem CID 77114651) has the molecular formula C9H13F3O
and a molecular weight of 194.20 g/mol. Its IUPAC name is 1-[(E)-3,3,3-trifluoroprop-1-enyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[(E)-3,3,3-trifluoroprop-1-enyl]cyclohexan-1-ol |
| PubChem CID | 77114651 |
| Molecular Formula | C9H13F3O |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-[(E)-3,3,3-trifluoroprop-1-enyl]cyclohexan-1-ol |
| SMILES | OC1(/C=C/C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C9H13F3O/c10-9(11,12)7-6-8(13)4-2-1-3-5-8/h6-7,13H,1-5H2/b7-6+ |
| InChIKey | KAWZCNMORJTCKL-VOTSOKGWSA-N |
| XLogP | 2.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-3,3,3-trifluoroprop-1-enyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-3,3,3-trifluoroprop-1-enyl]cyclohexan-1-ol?
The IUPAC name of 1-[(E)-3,3,3-trifluoroprop-1-enyl]cyclohexan-1-ol (CID 77114651) is 1-[(E)-3,3,3-trifluoroprop-1-enyl]cyclohexan-1-ol.
What is the SMILES notation for 1-[(E)-3,3,3-trifluoroprop-1-enyl]cyclohexan-1-ol?
The canonical SMILES for 1-[(E)-3,3,3-trifluoroprop-1-enyl]cyclohexan-1-ol is OC1(/C=C/C(F)(F)F)CCCCC1.
What is the InChIKey of 1-[(E)-3,3,3-trifluoroprop-1-enyl]cyclohexan-1-ol?
The InChIKey is KAWZCNMORJTCKL-VOTSOKGWSA-N. The full InChI is InChI=1S/C9H13F3O/c10-9(11,12)7-6-8(13)4-2-1-3-5-8/h6-7,13H,1-5H2/b7-6+.
What are the key properties of 1-[(E)-3,3,3-trifluoroprop-1-enyl]cyclohexan-1-ol?
1-[(E)-3,3,3-trifluoroprop-1-enyl]cyclohexan-1-ol has a molecular weight of 194.20 g/mol, XLogP of 2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-3,3,3-trifluoroprop-1-enyl]cyclohexan-1-ol is sourced from PubChem (CID 77114651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).