C12H14N3O4+ — CID 77116051
methyl 1,3,7-trimethyl-2,4-dioxo-4aH-pyrido[2,3-d]pyrimidin-1-ium-6-carboxylate (PubChem CID 77116051) has the molecular formula C12H14N3O4+ and a molecular weight of 264.26 g/mol. Its IUPAC name is methyl 1,3,7-trimethyl-2,4-dioxo-4aH-pyrido[2,3-d]pyrimidin-1-ium-6-carboxylate.
| Compound Name | methyl 1,3,7-trimethyl-2,4-dioxo-4aH-pyrido[2,3-d]pyrimidin-1-ium-6-carboxylate |
|---|---|
| PubChem CID | 77116051 |
| Molecular Formula | C12H14N3O4+ |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | methyl 1,3,7-trimethyl-2,4-dioxo-4aH-pyrido[2,3-d]pyrimidin-1-ium-6-carboxylate |
| SMILES | COC(=O)C1=CC2C(=O)N(C)C(=O)[N+](C)=C2N=C1C |
| InChI | InChI=1S/C12H14N3O4/c1-6-7(11(17)19-4)5-8-9(13-6)14(2)12(18)15(3)10(8)16/h5,8H,1-4H3/q+1 |
| InChIKey | UGJWYQKZLSQLKX-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|