C13H10N4O3S — CID 77120122
3-[5-[(3-oxo-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)methyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 77120122) has the molecular formula C13H10N4O3S and a molecular weight of 302.31 g/mol. Its IUPAC name is 3-[5-[(3-oxo-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)methyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 3-[5-[(3-oxo-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)methyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77120122 |
| Molecular Formula | C13H10N4O3S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 3-[5-[(3-oxo-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)methyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(Cn2nc3cnccn3c2=O)s1 |
| InChI | InChI=1S/C13H10N4O3S/c18-12(19)4-3-9-1-2-10(21-9)8-17-13(20)16-6-5-14-7-11(16)15-17/h1-7H,8H2,(H,18,19) |
| InChIKey | UODYBHSKDBJJLU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|