C23H22N4O3 — CID 7712741
[(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enoate (PubChem CID 7712741) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enoate.
| Compound Name | [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7712741 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enoate |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)O[C@H](C)C(=O)Nc2ccc(C#N)cc2)c(C)n1C1CC1 |
| InChI | InChI=1S/C23H22N4O3/c1-14-10-18(15(2)27(14)21-8-9-21)11-19(13-25)23(29)30-16(3)22(28)26-20-6-4-17(12-24)5-7-20/h4-7,10-11,16,21H,8-9H2,1-3H3,(H,26,28)/b19-11+/t16-/m1/s1 |
| InChIKey | PFJZISULSKCKJP-YDDPGSGASA-N |
| XLogP | 3.79 |
| TPSA | 107.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|