C8H6BrF4N — CID 77127823
1-(2-bromo-6-fluorophenyl)-2,2,2-trifluoroethanamine (PubChem CID 77127823) has the molecular formula C8H6BrF4N and a molecular weight of 272.04 g/mol. Its IUPAC name is 1-(2-bromo-6-fluorophenyl)-2,2,2-trifluoroethanamine.
| Compound Name | 1-(2-bromo-6-fluorophenyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 77127823 |
| Molecular Formula | C8H6BrF4N |
| Molecular Weight | 272.04 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | 1-(2-bromo-6-fluorophenyl)-2,2,2-trifluoroethanamine |
| SMILES | NC(c1c(F)cccc1Br)C(F)(F)F |
| InChI | InChI=1S/C8H6BrF4N/c9-4-2-1-3-5(10)6(4)7(14)8(11,12)13/h1-3,7H,14H2 |
| InChIKey | RPWFTSOPOYPOJB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.04 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |