C9H9F2NO3 — CID 77129930
2-amino-2-(2,2-difluoro-1,3-benzodioxol-5-yl)ethanol (PubChem CID 77129930) has the molecular formula C9H9F2NO3 and a molecular weight of 217.17 g/mol. Its IUPAC name is 2-amino-2-(2,2-difluoro-1,3-benzodioxol-5-yl)ethanol.
| Compound Name | 2-amino-2-(2,2-difluoro-1,3-benzodioxol-5-yl)ethanol |
|---|---|
| PubChem CID | 77129930 |
| Molecular Formula | C9H9F2NO3 |
| Molecular Weight | 217.17 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2-amino-2-(2,2-difluoro-1,3-benzodioxol-5-yl)ethanol |
| SMILES | NC(CO)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C9H9F2NO3/c10-9(11)14-7-2-1-5(6(12)4-13)3-8(7)15-9/h1-3,6,13H,4,12H2 |
| InChIKey | XRHHQBSWMJPLHM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |