C11H13F2NO — CID 77131566
2-(3,5-difluoro-4-methoxyphenyl)pyrrolidine (PubChem CID 77131566) has the molecular formula C11H13F2NO and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-(3,5-difluoro-4-methoxyphenyl)pyrrolidine.
| Compound Name | 2-(3,5-difluoro-4-methoxyphenyl)pyrrolidine |
|---|---|
| PubChem CID | 77131566 |
| Molecular Formula | C11H13F2NO |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-(3,5-difluoro-4-methoxyphenyl)pyrrolidine |
| SMILES | COc1c(F)cc(C2CCCN2)cc1F |
| InChI | InChI=1S/C11H13F2NO/c1-15-11-8(12)5-7(6-9(11)13)10-3-2-4-14-10/h5-6,10,14H,2-4H2,1H3 |
| InChIKey | CYCMSCJOSLPTKW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |