C18H17NO2 — CID 77133271
N-[4-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethoxy)-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 77133271) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[4-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethoxy)-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | N-[4-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethoxy)-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 77133271 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N-[4-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethoxy)-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | ON=C1CCc2c(OCC3Cc4ccccc43)cccc21 |
| InChI | InChI=1S/C18H17NO2/c20-19-17-9-8-16-15(17)6-3-7-18(16)21-11-13-10-12-4-1-2-5-14(12)13/h1-7,13,20H,8-11H2 |
| InChIKey | RZXWMGVHOQNJTE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|