2-[(1-propylpyrrol-2-yl)methylideneamino]oxyacetic acid

C10H14N2O3 — CID 77134242

IUPAC2-[(1-propylpyrrol-2-yl)methylideneamino]oxyacetic acid
SMILESCCCn1cccc1C=NOCC(=O)O
InChIInChI=1S/C10H14N2O3/c1-2-5-12-6-3-4-9(12)7-11-15-8-10(13)14/h3-4,6-7H,2,5,8H2,1H3,(H,13,14)
InChIKeyZRNLTXKKKYZSOC-UHFFFAOYSA-N
MW210.23 g/mol
LogP1.33
Rot. Bonds6

About 2-[(1-propylpyrrol-2-yl)methylideneamino]oxyacetic acid

2-[(1-propylpyrrol-2-yl)methylideneamino]oxyacetic acid (PubChem CID 77134242) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-[(1-propylpyrrol-2-yl)methylideneamino]oxyacetic acid.

Molecular Properties

Compound Name2-[(1-propylpyrrol-2-yl)methylideneamino]oxyacetic acid
PubChem CID77134242
Molecular FormulaC10H14N2O3
Molecular Weight210.23 g/mol
Exact Mass210.10
IUPAC Name2-[(1-propylpyrrol-2-yl)methylideneamino]oxyacetic acid
SMILESCCCn1cccc1C=NOCC(=O)O
InChIInChI=1S/C10H14N2O3/c1-2-5-12-6-3-4-9(12)7-11-15-8-10(13)14/h3-4,6-7H,2,5,8H2,1H3,(H,13,14)
InChIKeyZRNLTXKKKYZSOC-UHFFFAOYSA-N
XLogP1.33
TPSA63.82 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.23
LogP ≤ 51.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-[(1-propylpyrrol-2-yl)methylideneamino]oxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1-propylpyrrol-2-yl)methylideneamino]oxyacetic acid?
The IUPAC name of 2-[(1-propylpyrrol-2-yl)methylideneamino]oxyacetic acid (CID 77134242) is 2-[(1-propylpyrrol-2-yl)methylideneamino]oxyacetic acid.
What is the SMILES notation for 2-[(1-propylpyrrol-2-yl)methylideneamino]oxyacetic acid?
The canonical SMILES for 2-[(1-propylpyrrol-2-yl)methylideneamino]oxyacetic acid is CCCn1cccc1C=NOCC(=O)O.
What is the InChIKey of 2-[(1-propylpyrrol-2-yl)methylideneamino]oxyacetic acid?
The InChIKey is ZRNLTXKKKYZSOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3/c1-2-5-12-6-3-4-9(12)7-11-15-8-10(13)14/h3-4,6-7H,2,5,8H2,1H3,(H,13,14).
What are the key properties of 2-[(1-propylpyrrol-2-yl)methylideneamino]oxyacetic acid?
2-[(1-propylpyrrol-2-yl)methylideneamino]oxyacetic acid has a molecular weight of 210.23 g/mol, XLogP of 1.33, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-propylpyrrol-2-yl)methylideneamino]oxyacetic acid is sourced from PubChem (CID 77134242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).