About 2,6-dichloro-3-[(3,5-dichlorophenyl)methyl]pyridine-4-carboxylic acid
2,6-dichloro-3-[(3,5-dichlorophenyl)methyl]pyridine-4-carboxylic acid (PubChem CID 77134525) has the molecular formula C13H7Cl4NO2
and a molecular weight of 351.02 g/mol. Its IUPAC name is 2,6-dichloro-3-[(3,5-dichlorophenyl)methyl]pyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | 2,6-dichloro-3-[(3,5-dichlorophenyl)methyl]pyridine-4-carboxylic acid |
| PubChem CID | 77134525 |
| Molecular Formula | C13H7Cl4NO2 |
| Molecular Weight | 351.02 g/mol |
| Exact Mass | 348.92 |
| IUPAC Name | 2,6-dichloro-3-[(3,5-dichlorophenyl)methyl]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)nc(Cl)c1Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H7Cl4NO2/c14-7-1-6(2-8(15)4-7)3-9-10(13(19)20)5-11(16)18-12(9)17/h1-2,4-5H,3H2,(H,19,20) |
| InChIKey | FJIQIVVBVUMHTP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.02 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichloro-3-[(3,5-dichlorophenyl)methyl]pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-3-[(3,5-dichlorophenyl)methyl]pyridine-4-carboxylic acid?
The IUPAC name of 2,6-dichloro-3-[(3,5-dichlorophenyl)methyl]pyridine-4-carboxylic acid (CID 77134525) is 2,6-dichloro-3-[(3,5-dichlorophenyl)methyl]pyridine-4-carboxylic acid.
What is the SMILES notation for 2,6-dichloro-3-[(3,5-dichlorophenyl)methyl]pyridine-4-carboxylic acid?
The canonical SMILES for 2,6-dichloro-3-[(3,5-dichlorophenyl)methyl]pyridine-4-carboxylic acid is O=C(O)c1cc(Cl)nc(Cl)c1Cc1cc(Cl)cc(Cl)c1.
What is the InChIKey of 2,6-dichloro-3-[(3,5-dichlorophenyl)methyl]pyridine-4-carboxylic acid?
The InChIKey is FJIQIVVBVUMHTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7Cl4NO2/c14-7-1-6(2-8(15)4-7)3-9-10(13(19)20)5-11(16)18-12(9)17/h1-2,4-5H,3H2,(H,19,20).
What are the key properties of 2,6-dichloro-3-[(3,5-dichlorophenyl)methyl]pyridine-4-carboxylic acid?
2,6-dichloro-3-[(3,5-dichlorophenyl)methyl]pyridine-4-carboxylic acid has a molecular weight of 351.02 g/mol, XLogP of 4.98, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-3-[(3,5-dichlorophenyl)methyl]pyridine-4-carboxylic acid is sourced from PubChem (CID 77134525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).