4-bromo-2,5-dimethylthiophene-3-carboxylic acid

C7H7BrO2S — CID 77134617

IUPAC4-bromo-2,5-dimethylthiophene-3-carboxylic acid
SMILESCc1sc(C)c(C(=O)O)c1Br
InChIInChI=1S/C7H7BrO2S/c1-3-5(7(9)10)6(8)4(2)11-3/h1-2H3,(H,9,10)
InChIKeySRIDTNDGGKOVNU-UHFFFAOYSA-N
MW235.10 g/mol
LogP2.83
Rot. Bonds1

About 4-bromo-2,5-dimethylthiophene-3-carboxylic acid

4-bromo-2,5-dimethylthiophene-3-carboxylic acid (PubChem CID 77134617) has the molecular formula C7H7BrO2S and a molecular weight of 235.10 g/mol. Its IUPAC name is 4-bromo-2,5-dimethylthiophene-3-carboxylic acid.

Molecular Properties

Compound Name4-bromo-2,5-dimethylthiophene-3-carboxylic acid
PubChem CID77134617
Molecular FormulaC7H7BrO2S
Molecular Weight235.10 g/mol
Exact Mass233.94
IUPAC Name4-bromo-2,5-dimethylthiophene-3-carboxylic acid
SMILESCc1sc(C)c(C(=O)O)c1Br
InChIInChI=1S/C7H7BrO2S/c1-3-5(7(9)10)6(8)4(2)11-3/h1-2H3,(H,9,10)
InChIKeySRIDTNDGGKOVNU-UHFFFAOYSA-N
XLogP2.83
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.10
LogP ≤ 52.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-bromo-2,5-dimethylthiophene-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3,4-Dibromothiophene-2-carboxylic acid
CID 625409
4-Bromo-5-methylthiophene-2-carboxylic acid
CID 818889
Trimethylthiophene-2-carboxylic acid
CID 10877558
5-Bromo-4-methylthiophene-2-carboxylic acid
CID 21899459
3-Bromo-4-methylthiophene-2-carboxylic acid
CID 819065
4-Bromo-3-methylthiophene-2-carboxylic acid
CID 2757073
2-Bromo-4,5-dimethylthiophene-3-carboxylic acid
CID 11128264
5-Bromo-3-methylthiophene-2-carboxylic acid
CID 18176663
4,5-Dibromo-3-methyl-2-thiophenecarboxylic acid
CID 44248130
2-Bromo-5-ethylthiophene-3-carboxylic acid
CID 59542522
5-Bromo-2-methylthiophene-3-carboxylic acid
CID 65639309
5-Bromo-4-ethylthiophene-2-carboxylic acid
CID 69268760

Frequently Asked Questions

What is the IUPAC name of 4-bromo-2,5-dimethylthiophene-3-carboxylic acid?
The IUPAC name of 4-bromo-2,5-dimethylthiophene-3-carboxylic acid (CID 77134617) is 4-bromo-2,5-dimethylthiophene-3-carboxylic acid.
What is the SMILES notation for 4-bromo-2,5-dimethylthiophene-3-carboxylic acid?
The canonical SMILES for 4-bromo-2,5-dimethylthiophene-3-carboxylic acid is Cc1sc(C)c(C(=O)O)c1Br.
What is the InChIKey of 4-bromo-2,5-dimethylthiophene-3-carboxylic acid?
The InChIKey is SRIDTNDGGKOVNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrO2S/c1-3-5(7(9)10)6(8)4(2)11-3/h1-2H3,(H,9,10).
What are the key properties of 4-bromo-2,5-dimethylthiophene-3-carboxylic acid?
4-bromo-2,5-dimethylthiophene-3-carboxylic acid has a molecular weight of 235.10 g/mol, XLogP of 2.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,5-dimethylthiophene-3-carboxylic acid is sourced from PubChem (CID 77134617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).