About methanesulfonate;1-methyl-3-propyl-1,2-dihydroimidazol-1-ium
methanesulfonate;1-methyl-3-propyl-1,2-dihydroimidazol-1-ium (PubChem CID 77134620) has the molecular formula C8H18N2O3S
and a molecular weight of 222.31 g/mol. Its IUPAC name is methanesulfonate;1-methyl-3-propyl-1,2-dihydroimidazol-1-ium.
Molecular Properties
| Compound Name | methanesulfonate;1-methyl-3-propyl-1,2-dihydroimidazol-1-ium |
| PubChem CID | 77134620 |
| Molecular Formula | C8H18N2O3S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | methanesulfonate;1-methyl-3-propyl-1,2-dihydroimidazol-1-ium |
| SMILES | CCCN1C=C[NH+](C)C1.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C7H14N2.CH4O3S/c1-3-4-9-6-5-8(2)7-9;1-5(2,3)4/h5-6H,3-4,7H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | GPJMFSUXLZGWOB-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 64.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonate;1-methyl-3-propyl-1,2-dihydroimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonate;1-methyl-3-propyl-1,2-dihydroimidazol-1-ium?
The IUPAC name of methanesulfonate;1-methyl-3-propyl-1,2-dihydroimidazol-1-ium (CID 77134620) is methanesulfonate;1-methyl-3-propyl-1,2-dihydroimidazol-1-ium.
What is the SMILES notation for methanesulfonate;1-methyl-3-propyl-1,2-dihydroimidazol-1-ium?
The canonical SMILES for methanesulfonate;1-methyl-3-propyl-1,2-dihydroimidazol-1-ium is CCCN1C=C[NH+](C)C1.CS(=O)(=O)[O-].
What is the InChIKey of methanesulfonate;1-methyl-3-propyl-1,2-dihydroimidazol-1-ium?
The InChIKey is GPJMFSUXLZGWOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.CH4O3S/c1-3-4-9-6-5-8(2)7-9;1-5(2,3)4/h5-6H,3-4,7H2,1-2H3;1H3,(H,2,3,4).
What are the key properties of methanesulfonate;1-methyl-3-propyl-1,2-dihydroimidazol-1-ium?
methanesulfonate;1-methyl-3-propyl-1,2-dihydroimidazol-1-ium has a molecular weight of 222.31 g/mol, XLogP of -1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonate;1-methyl-3-propyl-1,2-dihydroimidazol-1-ium is sourced from PubChem (CID 77134620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).