C8H10Cl2F6O — CID 77134709
4-chloro-3-(1-chloro-3,3,4-trifluorobutan-2-yl)oxy-1,2,2-trifluorobutane (PubChem CID 77134709) has the molecular formula C8H10Cl2F6O and a molecular weight of 307.06 g/mol. Its IUPAC name is 4-chloro-3-(1-chloro-3,3,4-trifluorobutan-2-yl)oxy-1,2,2-trifluorobutane.
| Compound Name | 4-chloro-3-(1-chloro-3,3,4-trifluorobutan-2-yl)oxy-1,2,2-trifluorobutane |
|---|---|
| PubChem CID | 77134709 |
| Molecular Formula | C8H10Cl2F6O |
| Molecular Weight | 307.06 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 4-chloro-3-(1-chloro-3,3,4-trifluorobutan-2-yl)oxy-1,2,2-trifluorobutane |
| SMILES | FCC(F)(F)C(CCl)OC(CCl)C(F)(F)CF |
| InChI | InChI=1S/C8H10Cl2F6O/c9-1-5(7(13,14)3-11)17-6(2-10)8(15,16)4-12/h5-6H,1-4H2 |
| InChIKey | GXPPLUDYDXZTMA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.06 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|