C26H32O4SSi — CID 77134921
[3-[tert-butyl(diphenyl)silyl]oxy-1,1,2,2,3,3-hexadeuteriopropyl] 4-methylbenzenesulfonate (PubChem CID 77134921) has the molecular formula C26H32O4SSi and a molecular weight of 474.73 g/mol. Its IUPAC name is [3-[tert-butyl(diphenyl)silyl]oxy-1,1,2,2,3,3-hexadeuteriopropyl] 4-methylbenzenesulfonate.
| Compound Name | [3-[tert-butyl(diphenyl)silyl]oxy-1,1,2,2,3,3-hexadeuteriopropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 77134921 |
| Molecular Formula | C26H32O4SSi |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | [3-[tert-butyl(diphenyl)silyl]oxy-1,1,2,2,3,3-hexadeuteriopropyl] 4-methylbenzenesulfonate |
| SMILES | [2H]C([2H])(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C([2H])([2H])C([2H])([2H])OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H32O4SSi/c1-22-16-18-23(19-17-22)31(27,28)29-20-11-21-30-32(26(2,3)4,24-12-7-5-8-13-24)25-14-9-6-10-15-25/h5-10,12-19H,11,20-21H2,1-4H3/i11D2,20D2,21D2 |
| InChIKey | NJBNQFZXAGKOEN-XCQZATQVSA-N |
| XLogP | 4.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|