C19H28N6O7 — CID 77137105
ethyl 5-[[2-[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]pyrazolidine-3-carbonyl]amino]-1,3,4-oxadiazole-2-carboxylate (PubChem CID 77137105) has the molecular formula C19H28N6O7 and a molecular weight of 452.47 g/mol. Its IUPAC name is ethyl 5-[[2-[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]pyrazolidine-3-carbonyl]amino]-1,3,4-oxadiazole-2-carboxylate.
| Compound Name | ethyl 5-[[2-[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]pyrazolidine-3-carbonyl]amino]-1,3,4-oxadiazole-2-carboxylate |
|---|---|
| PubChem CID | 77137105 |
| Molecular Formula | C19H28N6O7 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | ethyl 5-[[2-[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]pyrazolidine-3-carbonyl]amino]-1,3,4-oxadiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nnc(NC(=O)C2CCNN2C(=O)C(CC2CCCC2)CN(O)C=O)o1 |
| InChI | InChI=1S/C19H28N6O7/c1-2-31-18(29)16-22-23-19(32-16)21-15(27)14-7-8-20-25(14)17(28)13(10-24(30)11-26)9-12-5-3-4-6-12/h11-14,20,30H,2-10H2,1H3,(H,21,23,27) |
| InChIKey | JRKBNYLZQFVJGB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 167.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|