C36H52N2O3 — CID 77137402
N-(11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl)heptanamide (PubChem CID 77137402) has the molecular formula C36H52N2O3 and a molecular weight of 560.82 g/mol. Its IUPAC name is N-(11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl)heptanamide.
| Compound Name | N-(11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl)heptanamide |
|---|---|
| PubChem CID | 77137402 |
| Molecular Formula | C36H52N2O3 |
| Molecular Weight | 560.82 g/mol |
| Exact Mass | 560.40 |
| IUPAC Name | N-(11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl)heptanamide |
| SMILES | CCCCCCC(=O)NC12CCC(C)(C)CC1C1C(=O)C=C3C4(C)C=C(C#N)C(=O)C(C)C4CCC3(C)C1(C)CC2 |
| InChI | InChI=1S/C36H52N2O3/c1-8-9-10-11-12-29(40)38-36-17-15-32(3,4)21-26(36)30-27(39)19-28-33(5)20-24(22-37)31(41)23(2)25(33)13-14-34(28,6)35(30,7)16-18-36/h19-20,23,25-26,30H,8-18,21H2,1-7H3,(H,38,40) |
| InChIKey | GPDNAKQBDXGESM-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.82 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|