C18H19N9O — CID 77138489
3-(3-aminopyrrolidin-1-yl)-N-methyl-5-pyrimidin-5-yloxy-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-10-amine (PubChem CID 77138489) has the molecular formula C18H19N9O and a molecular weight of 377.41 g/mol. Its IUPAC name is 3-(3-aminopyrrolidin-1-yl)-N-methyl-5-pyrimidin-5-yloxy-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-10-amine.
| Compound Name | 3-(3-aminopyrrolidin-1-yl)-N-methyl-5-pyrimidin-5-yloxy-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-10-amine |
|---|---|
| PubChem CID | 77138489 |
| Molecular Formula | C18H19N9O |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 3-(3-aminopyrrolidin-1-yl)-N-methyl-5-pyrimidin-5-yloxy-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-10-amine |
| SMILES | CNc1nccc2c1[nH]c1nc(Oc3cncnc3)nc(N3CCC(N)C3)c12 |
| InChI | InChI=1S/C18H19N9O/c1-20-16-14-12(2-4-23-16)13-15(24-14)25-18(28-11-6-21-9-22-7-11)26-17(13)27-5-3-10(19)8-27/h2,4,6-7,9-10H,3,5,8,19H2,1H3,(H,20,23)(H,24,25,26) |
| InChIKey | JJFVCRYUSZOSIJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |