C11H18N2O4S2 — CID 77138825
5-(hydroxymethyl)-2-(thiolan-3-ylamino)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 77138825) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-(thiolan-3-ylamino)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | 5-(hydroxymethyl)-2-(thiolan-3-ylamino)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 77138825 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 5-(hydroxymethyl)-2-(thiolan-3-ylamino)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | OCC1OC2SC(NC3CCSC3)=NC2C(O)C1O |
| InChI | InChI=1S/C11H18N2O4S2/c14-3-6-8(15)9(16)7-10(17-6)19-11(13-7)12-5-1-2-18-4-5/h5-10,14-16H,1-4H2,(H,12,13) |
| InChIKey | IDBPKVCUXYQKID-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |