C25H35NO3 — CID 77138985
methyl 2-(1-benzyl-7-methyl-4a-pent-4-enoyl-2,3,4,5,6,7,8,8a-octahydroquinolin-5-yl)acetate (PubChem CID 77138985) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is methyl 2-(1-benzyl-7-methyl-4a-pent-4-enoyl-2,3,4,5,6,7,8,8a-octahydroquinolin-5-yl)acetate.
| Compound Name | methyl 2-(1-benzyl-7-methyl-4a-pent-4-enoyl-2,3,4,5,6,7,8,8a-octahydroquinolin-5-yl)acetate |
|---|---|
| PubChem CID | 77138985 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | methyl 2-(1-benzyl-7-methyl-4a-pent-4-enoyl-2,3,4,5,6,7,8,8a-octahydroquinolin-5-yl)acetate |
| SMILES | C=CCCC(=O)C12CCCN(Cc3ccccc3)C1CC(C)CC2CC(=O)OC |
| InChI | InChI=1S/C25H35NO3/c1-4-5-12-23(27)25-13-9-14-26(18-20-10-7-6-8-11-20)22(25)16-19(2)15-21(25)17-24(28)29-3/h4,6-8,10-11,19,21-22H,1,5,9,12-18H2,2-3H3 |
| InChIKey | RMHFZMUPELDPMO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|