C17H17ClFNO4 — CID 7713955
(2S)-N-(2-chloro-4-fluorophenyl)-2-(3,5-dimethoxyphenoxy)propanamide (PubChem CID 7713955) has the molecular formula C17H17ClFNO4 and a molecular weight of 353.78 g/mol. Its IUPAC name is (2S)-N-(2-chloro-4-fluorophenyl)-2-(3,5-dimethoxyphenoxy)propanamide.
| Compound Name | (2S)-N-(2-chloro-4-fluorophenyl)-2-(3,5-dimethoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 7713955 |
| Molecular Formula | C17H17ClFNO4 |
| Molecular Weight | 353.78 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | (2S)-N-(2-chloro-4-fluorophenyl)-2-(3,5-dimethoxyphenoxy)propanamide |
| SMILES | COc1cc(OC)cc(O[C@@H](C)C(=O)Nc2ccc(F)cc2Cl)c1 |
| InChI | InChI=1S/C17H17ClFNO4/c1-10(17(21)20-16-5-4-11(19)6-15(16)18)24-14-8-12(22-2)7-13(9-14)23-3/h4-10H,1-3H3,(H,20,21)/t10-/m0/s1 |
| InChIKey | NSVMJASKUOPKPB-JTQLQIEISA-N |
| XLogP | 3.90 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.78 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |