C19H33NO4 — CID 77143333
2-[(7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl)oxy]-N-methylacetamide (PubChem CID 77143333) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-[(7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl)oxy]-N-methylacetamide.
| Compound Name | 2-[(7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl)oxy]-N-methylacetamide |
|---|---|
| PubChem CID | 77143333 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | 2-[(7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl)oxy]-N-methylacetamide |
| SMILES | CNC(=O)COC1C(C)C=C(C)COCCCCCC=CC1OC |
| InChI | InChI=1S/C19H33NO4/c1-15-12-16(2)19(24-14-18(21)20-3)17(22-4)10-8-6-5-7-9-11-23-13-15/h8,10,12,16-17,19H,5-7,9,11,13-14H2,1-4H3,(H,20,21) |
| InChIKey | MVRVMHUEQRTZFJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|