C39H55FN6O8 — CID 77144789
N-[1-[(16,16-diethyl-13,17-dimethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetrazatricyclo[17.3.0.07,11]docosan-3-yl)amino]-3-(3-fluorophenyl)-1-oxopropan-2-yl]hept-2-enamide (PubChem CID 77144789) has the molecular formula C39H55FN6O8 and a molecular weight of 754.90 g/mol. Its IUPAC name is N-[1-[(16,16-diethyl-13,17-dimethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetrazatricyclo[17.3.0.07,11]docosan-3-yl)amino]-3-(3-fluorophenyl)-1-oxopropan-2-yl]hept-2-enamide.
| Compound Name | N-[1-[(16,16-diethyl-13,17-dimethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetrazatricyclo[17.3.0.07,11]docosan-3-yl)amino]-3-(3-fluorophenyl)-1-oxopropan-2-yl]hept-2-enamide |
|---|---|
| PubChem CID | 77144789 |
| Molecular Formula | C39H55FN6O8 |
| Molecular Weight | 754.90 g/mol |
| Exact Mass | 754.41 |
| IUPAC Name | N-[1-[(16,16-diethyl-13,17-dimethyl-2,6,12,15,18-pentaoxo-5-oxa-1,11,14,17-tetrazatricyclo[17.3.0.07,11]docosan-3-yl)amino]-3-(3-fluorophenyl)-1-oxopropan-2-yl]hept-2-enamide |
| SMILES | CCCCC=CC(=O)NC(Cc1cccc(F)c1)C(=O)NC1COC(=O)C2CCCN2C(=O)C(C)NC(=O)C(CC)(CC)N(C)C(=O)C2CCCN2C1=O |
| InChI | InChI=1S/C39H55FN6O8/c1-6-9-10-11-19-32(47)42-28(23-26-15-12-16-27(40)22-26)33(48)43-29-24-54-37(52)31-18-14-21-46(31)34(49)25(4)41-38(53)39(7-2,8-3)44(5)36(51)30-17-13-20-45(30)35(29)50/h11-12,15-16,19,22,25,28-31H,6-10,13-14,17-18,20-21,23-24H2,1-5H3,(H,41,53)(H,42,47)(H,43,48) |
| InChIKey | PQADNAYFFPZDAA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 174.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.90 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|