C20H19NO3 — CID 77146054
1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-pyridin-2-ylprop-2-en-1-one (PubChem CID 77146054) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-pyridin-2-ylprop-2-en-1-one.
| Compound Name | 1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-pyridin-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 77146054 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-pyridin-2-ylprop-2-en-1-one |
| SMILES | COc1ccc(C(=O)C=Cc2ccccn2)c2c1C=CC(C)(C)O2 |
| InChI | InChI=1S/C20H19NO3/c1-20(2)12-11-16-18(23-3)10-8-15(19(16)24-20)17(22)9-7-14-6-4-5-13-21-14/h4-13H,1-3H3 |
| InChIKey | UCXPFDAETRBWHL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|