C25H26FN3O3 — CID 77149218
ethyl 6-[8-[(3-fluorophenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-6-oxohex-2-enoate (PubChem CID 77149218) has the molecular formula C25H26FN3O3 and a molecular weight of 435.50 g/mol. Its IUPAC name is ethyl 6-[8-[(3-fluorophenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-6-oxohex-2-enoate.
| Compound Name | ethyl 6-[8-[(3-fluorophenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-6-oxohex-2-enoate |
|---|---|
| PubChem CID | 77149218 |
| Molecular Formula | C25H26FN3O3 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | ethyl 6-[8-[(3-fluorophenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-6-oxohex-2-enoate |
| SMILES | CCOC(=O)C=CCCC(=O)N1CCc2c(n(Cc3cccc(F)c3)c3ncccc23)C1 |
| InChI | InChI=1S/C25H26FN3O3/c1-2-32-24(31)11-4-3-10-23(30)28-14-12-20-21-9-6-13-27-25(21)29(22(20)17-28)16-18-7-5-8-19(26)15-18/h4-9,11,13,15H,2-3,10,12,14,16-17H2,1H3 |
| InChIKey | IWWVDTAHVFKTFD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|