C25H25F3N6O3 — CID 77152882
2-[3-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-8-(3,4,5-trifluorophenoxy)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]propan-2-ol (PubChem CID 77152882) has the molecular formula C25H25F3N6O3 and a molecular weight of 514.51 g/mol. Its IUPAC name is 2-[3-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-8-(3,4,5-trifluorophenoxy)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]propan-2-ol.
| Compound Name | 2-[3-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-8-(3,4,5-trifluorophenoxy)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]propan-2-ol |
|---|---|
| PubChem CID | 77152882 |
| Molecular Formula | C25H25F3N6O3 |
| Molecular Weight | 514.51 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 2-[3-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-8-(3,4,5-trifluorophenoxy)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]propan-2-ol |
| SMILES | COc1nc(-c2nnc3n2CC(C(C)(C)O)CC3Oc2cc(F)c(F)c(F)c2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H25F3N6O3/c1-13-10-33(12-29-13)19-6-5-18(30-24(19)36-4)22-31-32-23-20(7-14(11-34(22)23)25(2,3)35)37-15-8-16(26)21(28)17(27)9-15/h5-6,8-10,12,14,20,35H,7,11H2,1-4H3 |
| InChIKey | JIOITFLLRZRXAW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|