C15H19NO2 — CID 77155611
6-ethyl-4,5,5a,7,8,8a-hexahydro-[1,3]benzodioxolo[6,7-e]indole (PubChem CID 77155611) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 6-ethyl-4,5,5a,7,8,8a-hexahydro-[1,3]benzodioxolo[6,7-e]indole.
| Compound Name | 6-ethyl-4,5,5a,7,8,8a-hexahydro-[1,3]benzodioxolo[6,7-e]indole |
|---|---|
| PubChem CID | 77155611 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 6-ethyl-4,5,5a,7,8,8a-hexahydro-[1,3]benzodioxolo[6,7-e]indole |
| SMILES | CCN1CCC2c3ccc4c(c3CCC21)OCO4 |
| InChI | InChI=1S/C15H19NO2/c1-2-16-8-7-11-10-4-6-14-15(18-9-17-14)12(10)3-5-13(11)16/h4,6,11,13H,2-3,5,7-9H2,1H3 |
| InChIKey | NHLHHQSPBREWJK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |