C16H12O — CID 77156845
tricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaen-6-ol (PubChem CID 77156845) has the molecular formula C16H12O and a molecular weight of 220.27 g/mol. Its IUPAC name is tricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaen-6-ol.
| Compound Name | tricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaen-6-ol |
|---|---|
| PubChem CID | 77156845 |
| Molecular Formula | C16H12O |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | tricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaen-6-ol |
| SMILES | Oc1cccc2c1=CC=CC=c1ccccc1=2 |
| InChI | InChI=1S/C16H12O/c17-16-11-5-10-14-13-8-3-1-6-12(13)7-2-4-9-15(14)16/h1-11,17H |
| InChIKey | JQPWNTWETCMRAA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |