About 6-(6-ethoxyimidazo[4,5-c]pyridin-3-yl)-N-piperidin-3-ylpyrazin-2-amine
6-(6-ethoxyimidazo[4,5-c]pyridin-3-yl)-N-piperidin-3-ylpyrazin-2-amine (PubChem CID 77160781) has the molecular formula C17H21N7O
and a molecular weight of 339.40 g/mol. Its IUPAC name is 6-(6-ethoxyimidazo[4,5-c]pyridin-3-yl)-N-piperidin-3-ylpyrazin-2-amine.
Molecular Properties
| Compound Name | 6-(6-ethoxyimidazo[4,5-c]pyridin-3-yl)-N-piperidin-3-ylpyrazin-2-amine |
| PubChem CID | 77160781 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 6-(6-ethoxyimidazo[4,5-c]pyridin-3-yl)-N-piperidin-3-ylpyrazin-2-amine |
| SMILES | CCOc1cc2ncn(-c3cncc(NC4CCCNC4)n3)c2cn1 |
| InChI | InChI=1S/C17H21N7O/c1-2-25-17-6-13-14(8-20-17)24(11-21-13)16-10-19-9-15(23-16)22-12-4-3-5-18-7-12/h6,8-12,18H,2-5,7H2,1H3,(H,22,23) |
| InChIKey | RPSYFKSFUHXBCW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 6-(6-ethoxyimidazo[4,5-c]pyridin-3-yl)-N-piperidin-3-ylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6-ethoxyimidazo[4,5-c]pyridin-3-yl)-N-piperidin-3-ylpyrazin-2-amine?
The IUPAC name of 6-(6-ethoxyimidazo[4,5-c]pyridin-3-yl)-N-piperidin-3-ylpyrazin-2-amine (CID 77160781) is 6-(6-ethoxyimidazo[4,5-c]pyridin-3-yl)-N-piperidin-3-ylpyrazin-2-amine.
What is the SMILES notation for 6-(6-ethoxyimidazo[4,5-c]pyridin-3-yl)-N-piperidin-3-ylpyrazin-2-amine?
The canonical SMILES for 6-(6-ethoxyimidazo[4,5-c]pyridin-3-yl)-N-piperidin-3-ylpyrazin-2-amine is CCOc1cc2ncn(-c3cncc(NC4CCCNC4)n3)c2cn1.
What is the InChIKey of 6-(6-ethoxyimidazo[4,5-c]pyridin-3-yl)-N-piperidin-3-ylpyrazin-2-amine?
The InChIKey is RPSYFKSFUHXBCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N7O/c1-2-25-17-6-13-14(8-20-17)24(11-21-13)16-10-19-9-15(23-16)22-12-4-3-5-18-7-12/h6,8-12,18H,2-5,7H2,1H3,(H,22,23).
What are the key properties of 6-(6-ethoxyimidazo[4,5-c]pyridin-3-yl)-N-piperidin-3-ylpyrazin-2-amine?
6-(6-ethoxyimidazo[4,5-c]pyridin-3-yl)-N-piperidin-3-ylpyrazin-2-amine has a molecular weight of 339.40 g/mol, XLogP of 1.77, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6-ethoxyimidazo[4,5-c]pyridin-3-yl)-N-piperidin-3-ylpyrazin-2-amine is sourced from PubChem (CID 77160781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).