About [(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate
[(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate (PubChem CID 7716172) has the molecular formula C17H15FN2O3S2
and a molecular weight of 378.45 g/mol. Its IUPAC name is [(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate.
Molecular Properties
| Compound Name | [(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate |
| PubChem CID | 7716172 |
| Molecular Formula | C17H15FN2O3S2 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | [(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate |
| SMILES | C[C@H](OC(=O)CCSc1ccc(F)cc1)c1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C17H15FN2O3S2/c1-11(16-19-20-17(23-16)14-3-2-9-25-14)22-15(21)8-10-24-13-6-4-12(18)5-7-13/h2-7,9,11H,8,10H2,1H3/t11-/m0/s1 |
| InChIKey | SONTUUFMLRHVQA-NSHDSACASA-N |
| XLogP | 4.72 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate?
The IUPAC name of [(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate (CID 7716172) is [(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate.
What is the SMILES notation for [(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate?
The canonical SMILES for [(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate is C[C@H](OC(=O)CCSc1ccc(F)cc1)c1nnc(-c2cccs2)o1.
What is the InChIKey of [(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate?
The InChIKey is SONTUUFMLRHVQA-NSHDSACASA-N. The full InChI is InChI=1S/C17H15FN2O3S2/c1-11(16-19-20-17(23-16)14-3-2-9-25-14)22-15(21)8-10-24-13-6-4-12(18)5-7-13/h2-7,9,11H,8,10H2,1H3/t11-/m0/s1.
What are the key properties of [(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate?
[(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate has a molecular weight of 378.45 g/mol, XLogP of 4.72, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate is sourced from PubChem (CID 7716172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).