About 10aH-[1,2,4]triazolo[4,3-a][1]benzazepine
10aH-[1,2,4]triazolo[4,3-a][1]benzazepine (PubChem CID 77165220) has the molecular formula C11H9N3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 10aH-[1,2,4]triazolo[4,3-a][1]benzazepine.
Molecular Properties
| Compound Name | 10aH-[1,2,4]triazolo[4,3-a][1]benzazepine |
| PubChem CID | 77165220 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 10aH-[1,2,4]triazolo[4,3-a][1]benzazepine |
| SMILES | C1=CC2=CC=Cc3nncn3C2C=C1 |
| InChI | InChI=1S/C11H9N3/c1-2-6-10-9(4-1)5-3-7-11-13-12-8-14(10)11/h1-8,10H |
| InChIKey | QLOLKQURULYMRS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10aH-[1,2,4]triazolo[4,3-a][1]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10aH-[1,2,4]triazolo[4,3-a][1]benzazepine?
The IUPAC name of 10aH-[1,2,4]triazolo[4,3-a][1]benzazepine (CID 77165220) is 10aH-[1,2,4]triazolo[4,3-a][1]benzazepine.
What is the SMILES notation for 10aH-[1,2,4]triazolo[4,3-a][1]benzazepine?
The canonical SMILES for 10aH-[1,2,4]triazolo[4,3-a][1]benzazepine is C1=CC2=CC=Cc3nncn3C2C=C1.
What is the InChIKey of 10aH-[1,2,4]triazolo[4,3-a][1]benzazepine?
The InChIKey is QLOLKQURULYMRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3/c1-2-6-10-9(4-1)5-3-7-11-13-12-8-14(10)11/h1-8,10H.
What are the key properties of 10aH-[1,2,4]triazolo[4,3-a][1]benzazepine?
10aH-[1,2,4]triazolo[4,3-a][1]benzazepine has a molecular weight of 183.21 g/mol, XLogP of 1.90, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10aH-[1,2,4]triazolo[4,3-a][1]benzazepine is sourced from PubChem (CID 77165220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).