About 1-[3-(3,4-difluoroanilino)-3-oxopropyl]piperidine-4-carboxamide
1-[3-(3,4-difluoroanilino)-3-oxopropyl]piperidine-4-carboxamide (PubChem CID 771678) has the molecular formula C15H19F2N3O2
and a molecular weight of 311.33 g/mol. Its IUPAC name is 1-[3-(3,4-difluoroanilino)-3-oxopropyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[3-(3,4-difluoroanilino)-3-oxopropyl]piperidine-4-carboxamide |
| PubChem CID | 771678 |
| Molecular Formula | C15H19F2N3O2 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 1-[3-(3,4-difluoroanilino)-3-oxopropyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(CCC(=O)Nc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C15H19F2N3O2/c16-12-2-1-11(9-13(12)17)19-14(21)5-8-20-6-3-10(4-7-20)15(18)22/h1-2,9-10H,3-8H2,(H2,18,22)(H,19,21) |
| InChIKey | AQZOIOYKHMLLNV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-(3,4-difluoroanilino)-3-oxopropyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3,4-difluoroanilino)-3-oxopropyl]piperidine-4-carboxamide?
The IUPAC name of 1-[3-(3,4-difluoroanilino)-3-oxopropyl]piperidine-4-carboxamide (CID 771678) is 1-[3-(3,4-difluoroanilino)-3-oxopropyl]piperidine-4-carboxamide.
What is the SMILES notation for 1-[3-(3,4-difluoroanilino)-3-oxopropyl]piperidine-4-carboxamide?
The canonical SMILES for 1-[3-(3,4-difluoroanilino)-3-oxopropyl]piperidine-4-carboxamide is NC(=O)C1CCN(CCC(=O)Nc2ccc(F)c(F)c2)CC1.
What is the InChIKey of 1-[3-(3,4-difluoroanilino)-3-oxopropyl]piperidine-4-carboxamide?
The InChIKey is AQZOIOYKHMLLNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F2N3O2/c16-12-2-1-11(9-13(12)17)19-14(21)5-8-20-6-3-10(4-7-20)15(18)22/h1-2,9-10H,3-8H2,(H2,18,22)(H,19,21).
What are the key properties of 1-[3-(3,4-difluoroanilino)-3-oxopropyl]piperidine-4-carboxamide?
1-[3-(3,4-difluoroanilino)-3-oxopropyl]piperidine-4-carboxamide has a molecular weight of 311.33 g/mol, XLogP of 1.49, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3,4-difluoroanilino)-3-oxopropyl]piperidine-4-carboxamide is sourced from PubChem (CID 771678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).