About dicyclohexyltin;dihydrate
dicyclohexyltin;dihydrate (PubChem CID 77168287) has the molecular formula C12H26O2Sn
and a molecular weight of 321.05 g/mol. Its IUPAC name is dicyclohexyltin;dihydrate.
Molecular Properties
| Compound Name | dicyclohexyltin;dihydrate |
| PubChem CID | 77168287 |
| Molecular Formula | C12H26O2Sn |
| Molecular Weight | 321.05 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | dicyclohexyltin;dihydrate |
| SMILES | C1CCC([Sn]C2CCCCC2)CC1.O.O |
| InChI | InChI=1S/2C6H11.2H2O.Sn/c2*1-2-4-6-5-3-1;;;/h2*1H,2-6H2;2*1H2; |
| InChIKey | RQTKZBBGVTVELW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 63.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.05 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dicyclohexyltin;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexyltin;dihydrate?
The IUPAC name of dicyclohexyltin;dihydrate (CID 77168287) is dicyclohexyltin;dihydrate.
What is the SMILES notation for dicyclohexyltin;dihydrate?
The canonical SMILES for dicyclohexyltin;dihydrate is C1CCC([Sn]C2CCCCC2)CC1.O.O.
What is the InChIKey of dicyclohexyltin;dihydrate?
The InChIKey is RQTKZBBGVTVELW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H11.2H2O.Sn/c2*1-2-4-6-5-3-1;;;/h2*1H,2-6H2;2*1H2;.
What are the key properties of dicyclohexyltin;dihydrate?
dicyclohexyltin;dihydrate has a molecular weight of 321.05 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexyltin;dihydrate is sourced from PubChem (CID 77168287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).