C20H31N3O3 — CID 77168395
1-tert-butyl-N-(5-hydroxy-2-adamantyl)-5-(methoxymethyl)pyrazole-4-carboxamide (PubChem CID 77168395) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 1-tert-butyl-N-(5-hydroxy-2-adamantyl)-5-(methoxymethyl)pyrazole-4-carboxamide.
| Compound Name | 1-tert-butyl-N-(5-hydroxy-2-adamantyl)-5-(methoxymethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 77168395 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 1-tert-butyl-N-(5-hydroxy-2-adamantyl)-5-(methoxymethyl)pyrazole-4-carboxamide |
| SMILES | COCc1c(C(=O)NC2C3CC4CC2CC(O)(C4)C3)cnn1C(C)(C)C |
| InChI | InChI=1S/C20H31N3O3/c1-19(2,3)23-16(11-26-4)15(10-21-23)18(24)22-17-13-5-12-6-14(17)9-20(25,7-12)8-13/h10,12-14,17,25H,5-9,11H2,1-4H3,(H,22,24) |
| InChIKey | NHEWGDPGAMTHIE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |