C24H18F2N4O5S — CID 77170492
3-[2-amino-6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]quinolin-3-yl]prop-2-enoic acid (PubChem CID 77170492) has the molecular formula C24H18F2N4O5S and a molecular weight of 512.49 g/mol. Its IUPAC name is 3-[2-amino-6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]quinolin-3-yl]prop-2-enoic acid.
| Compound Name | 3-[2-amino-6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]quinolin-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77170492 |
| Molecular Formula | C24H18F2N4O5S |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | 3-[2-amino-6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]quinolin-3-yl]prop-2-enoic acid |
| SMILES | COc1ncc(-c2ccc3nc(N)c(C=CC(=O)O)cc3c2)cc1NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H18F2N4O5S/c1-35-24-20(30-36(33,34)21-6-4-17(25)11-18(21)26)10-16(12-28-24)13-2-5-19-15(8-13)9-14(23(27)29-19)3-7-22(31)32/h2-12,30H,1H3,(H2,27,29)(H,31,32) |
| InChIKey | TYJMYKLZZBLUGL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 144.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|