About (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclobutanecarboxylate
(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclobutanecarboxylate (PubChem CID 7717376) has the molecular formula C13H14N2O3S
and a molecular weight of 278.33 g/mol. Its IUPAC name is (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclobutanecarboxylate.
Molecular Properties
| Compound Name | (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclobutanecarboxylate |
| PubChem CID | 7717376 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclobutanecarboxylate |
| SMILES | Cc1csc2nc(COC(=O)C3CCC3)cc(=O)n12 |
| InChI | InChI=1S/C13H14N2O3S/c1-8-7-19-13-14-10(5-11(16)15(8)13)6-18-12(17)9-3-2-4-9/h5,7,9H,2-4,6H2,1H3 |
| InChIKey | MSDKIJMZLZNGGP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclobutanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclobutanecarboxylate?
The IUPAC name of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclobutanecarboxylate (CID 7717376) is (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclobutanecarboxylate.
What is the SMILES notation for (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclobutanecarboxylate?
The canonical SMILES for (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclobutanecarboxylate is Cc1csc2nc(COC(=O)C3CCC3)cc(=O)n12.
What is the InChIKey of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclobutanecarboxylate?
The InChIKey is MSDKIJMZLZNGGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3S/c1-8-7-19-13-14-10(5-11(16)15(8)13)6-18-12(17)9-3-2-4-9/h5,7,9H,2-4,6H2,1H3.
What are the key properties of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclobutanecarboxylate?
(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclobutanecarboxylate has a molecular weight of 278.33 g/mol, XLogP of 1.91, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl cyclobutanecarboxylate is sourced from PubChem (CID 7717376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).